CAS 1935377-17-5 is the registry number for 3-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)-2,2-dimethylpropane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropane-1-sulfonyl chloride (CAS 1935377-17-5) is a chemical compound with the molecular formula C13H14ClNO4S and a molecular weight of 315.77 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropane-1-sulfonyl chloride. InChIKey: KONCLKJNCZWBPW-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO4S |
|---|---|
| Molecular weight | 315.77 g/mol |
| IUPAC name | 3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropane-1-sulfonyl chloride |
| InChIKey | KONCLKJNCZWBPW-UHFFFAOYSA-N |
| SMILES | CC(C)(CN1C(=O)C2=CC=CC=C2C1=O)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)