Products 63345-34-6

CAS 63345-34-6 is the registry number for 5-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)pentane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride (CAS 63345-34-6) is a chemical compound with the molecular formula C13H14ClNO4S and a molecular weight of 315.77 g/mol. IUPAC name: 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride. InChIKey: VOYSCQYOHPWPEV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14ClNO4S
Molecular weight315.77 g/mol
IUPAC name5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride
InChIKeyVOYSCQYOHPWPEV-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCS(=O)(=O)Cl

Computed by PubChem (NCBI)