CAS 63345-34-6 is the registry number for 5-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)pentane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride (CAS 63345-34-6) is a chemical compound with the molecular formula C13H14ClNO4S and a molecular weight of 315.77 g/mol. IUPAC name: 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride. InChIKey: VOYSCQYOHPWPEV-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO4S |
|---|---|
| Molecular weight | 315.77 g/mol |
| IUPAC name | 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride |
| InChIKey | VOYSCQYOHPWPEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCS(=O)(=O)Cl |
Computed by PubChem (NCBI)