CAS 1170674-20-0 appears in our catalog under these names: (R)-2-Amino-3-(4-(prop-2-yn-1-yloxy)phenyl)propanoic acid, 95%, 95%, H-D-Tyr(Propargyl)-OH, 95.0%. Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 50 mg, 250 mg, 100 mg, 10 mg, 5 mg.
(2R)-2-amino-3-(4-prop-2-ynoxyphenyl)propanoic acid (CAS 1170674-20-0) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: (2R)-2-amino-3-(4-prop-2-ynoxyphenyl)propanoic acid. InChIKey: JSXMFBNJRFXRCX-LLVKDONJSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-prop-2-ynoxyphenyl)propanoic acid |
| InChIKey | JSXMFBNJRFXRCX-LLVKDONJSA-N |
| SMILES | C#CCOC1=CC=C(C=C1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)