CAS 1170817-91-0 appears in our catalog under these names: C-Pyrazin-2-yl-methylamine oxalate, 95%, C-Pyrazin-2-yl-methylamine oxalate, 95%, 95%, Pyrazin-2-ylmethanamine oxalate, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 1g, 250mg.
Oxalic acid;pyrazin-2-ylmethanamine (CAS 1170817-91-0) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: oxalic acid;pyrazin-2-ylmethanamine. InChIKey: FBWZTNXFDAXJRF-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | oxalic acid;pyrazin-2-ylmethanamine |
| InChIKey | FBWZTNXFDAXJRF-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)