CAS 1609404-05-8 is the registry number for [1,2,4]Triazolo[4,3-a]pyridine-8-carboxylic acid dihydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid;dihydrate (CAS 1609404-05-8) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: [1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid;dihydrate. InChIKey: PHBJWVWRQXTFLC-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | [1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid;dihydrate |
| InChIKey | PHBJWVWRQXTFLC-UHFFFAOYSA-N |
| SMILES | C1=CN2C=NN=C2C(=C1)C(=O)O.O.O |
Computed by PubChem (NCBI)