CAS 956396-51-3 is the registry number for 3-(3-Methyl-4-nitro-1h-pyrazol-1-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-(3-methyl-4-nitropyrazol-1-yl)propanoic acid (CAS 956396-51-3) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: 3-(3-methyl-4-nitropyrazol-1-yl)propanoic acid. InChIKey: VLLXANRZXYDRFO-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 3-(3-methyl-4-nitropyrazol-1-yl)propanoic acid |
| InChIKey | VLLXANRZXYDRFO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1[N+](=O)[O-])CCC(=O)O |
Computed by PubChem (NCBI)