CAS 16935-04-9 appears in our catalog under these names: 3-(2-Methyl-4-nitro-1h-imidazol-1-yl)propanoic acid, 95%, 3-(2-Methyl-4-nitro-1H-imidazol-1-yl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(2-methyl-4-nitroimidazol-1-yl)propanoic acid (CAS 16935-04-9) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: 3-(2-methyl-4-nitroimidazol-1-yl)propanoic acid. InChIKey: QIJTUXYFQLHGJI-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 3-(2-methyl-4-nitroimidazol-1-yl)propanoic acid |
| InChIKey | QIJTUXYFQLHGJI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1CCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)