Products 117083-06-4

CAS 117083-06-4 is the registry number for tert-Butyl (2-aminoethyl)carbamate xhydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-aminoethyl)carbamate;hydrochloride (CAS 117083-06-4) is a chemical compound with the molecular formula C7H17ClN2O2 and a molecular weight of 196.67 g/mol. IUPAC name: tert-butyl N-(2-aminoethyl)carbamate;hydrochloride. InChIKey: XUHJJLCKXZTUJN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H17ClN2O2
Molecular weight196.67 g/mol
IUPAC nametert-butyl N-(2-aminoethyl)carbamate;hydrochloride
InChIKeyXUHJJLCKXZTUJN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCN.Cl

Computed by PubChem (NCBI)