Products 2243974-59-4
CAS 2243974-59-4 appears in our catalog under these names: Isopropyl (s)-2-amino-3-(methylamino)propanoate hydrochloride, 95%, Isopropyl (S)-2-Amino-3-(methylamino)propanoate Hydrochloride, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride (CAS 2243974-59-4) is a chemical compound with the molecular formula C7H17ClN2O2 and a molecular weight of 196.67 g/mol. IUPAC name: propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride. InChIKey: YBRRVPLMKZMHJF-RGMNGODLSA-N.
| Molecular formula | C7H17ClN2O2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | propan-2-yl (2S)-2-amino-3-(methylamino)propanoate;hydrochloride |
| InChIKey | YBRRVPLMKZMHJF-RGMNGODLSA-N |
| SMILES | CC(C)OC(=O)[C@H](CNC)N.Cl |
Computed by PubChem (NCBI)