CAS 192003-02-4 appears in our catalog under these names: H-β-HoLys-OH.2HCl, (S)-3,7-Diaminoheptanoic acid hydrochloride, 98%, 98%, H-HoLys-OH HCl, 98%. Offered by: Creative Peptides, Chemat, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
(3S)-3,7-diaminoheptanoic acid;hydrochloride (CAS 192003-02-4) is a chemical compound with the molecular formula C7H17ClN2O2 and a molecular weight of 196.67 g/mol. IUPAC name: (3S)-3,7-diaminoheptanoic acid;hydrochloride. InChIKey: DEUJYMGCFOTWFK-RGMNGODLSA-N.
| Molecular formula | C7H17ClN2O2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | (3S)-3,7-diaminoheptanoic acid;hydrochloride |
| InChIKey | DEUJYMGCFOTWFK-RGMNGODLSA-N |
| SMILES | C(CCN)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)