Products 2377034-87-0

CAS 2377034-87-0 is the registry number for Methyl N-methyl-N-(3-(methylamino)propyl)carbamate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl N-methyl-N-[3-(methylamino)propyl]carbamate;hydrochloride (CAS 2377034-87-0) is a chemical compound with the molecular formula C7H17ClN2O2 and a molecular weight of 196.67 g/mol. IUPAC name: methyl N-methyl-N-[3-(methylamino)propyl]carbamate;hydrochloride. InChIKey: XKULSQPUJNTCGR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H17ClN2O2
Molecular weight196.67 g/mol
IUPAC namemethyl N-methyl-N-[3-(methylamino)propyl]carbamate;hydrochloride
InChIKeyXKULSQPUJNTCGR-UHFFFAOYSA-N
SMILESCNCCCN(C)C(=O)OC.Cl

Computed by PubChem (NCBI)