Products 1170830-98-4
CAS 1170830-98-4 appears in our catalog under these names: 2-Methyl-1,2,3,4-tetrahydroquinolin-8-ol hydrochloride, 98%, 98%, 2-Methyl-1,2,3,4-tetrahydroquinolin-8-ol hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g, 2.5g.
2-methyl-1,2,3,4-tetrahydroquinolin-8-ol;hydrochloride (CAS 1170830-98-4) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 2-methyl-1,2,3,4-tetrahydroquinolin-8-ol;hydrochloride. InChIKey: RJJOGGCZHGESJX-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 2-methyl-1,2,3,4-tetrahydroquinolin-8-ol;hydrochloride |
| InChIKey | RJJOGGCZHGESJX-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(N1)C(=CC=C2)O.Cl |
Computed by PubChem (NCBI)