Products 1799434-48-2
CAS 1799434-48-2 appears in our catalog under these names: tert–Butyl ((2–(methylsulfonyl)pyrimidin–4–yl)methyl)carbamate, tert-Butyl ((2-(methylsulfonyl)pyrimidin-4-yl)methyl)carbamate, ≥97%, ≥97%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 25mg.
Tert-butyl N-[(2-methylsulfonylpyrimidin-4-yl)methyl]carbamate (CAS 1799434-48-2) is a chemical compound with the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. IUPAC name: tert-butyl N-[(2-methylsulfonylpyrimidin-4-yl)methyl]carbamate. InChIKey: OETOMMSENCSSKP-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O4S |
|---|---|
| Molecular weight | 287.34 g/mol |
| IUPAC name | tert-butyl N-[(2-methylsulfonylpyrimidin-4-yl)methyl]carbamate |
| InChIKey | OETOMMSENCSSKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC(=NC=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)