CAS 1171138-69-4 appears in our catalog under these names: 4–(3,4–Dichlorobenzyl)piperidine hydrochloride, 4-(3,4-Dichlorobenzyl)piperidine hydrochloride, 98%, 4-(3,4-Dichlorobenzyl)piperidine hydrochloride, 98%, 98%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g.
4-[(3,4-dichlorophenyl)methyl]piperidine;hydrochloride (CAS 1171138-69-4) is a chemical compound with the molecular formula C12H16Cl3N and a molecular weight of 280.6 g/mol. IUPAC name: 4-[(3,4-dichlorophenyl)methyl]piperidine;hydrochloride. InChIKey: QMXPLRLXVBJVNB-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl3N |
|---|---|
| Molecular weight | 280.6 g/mol |
| IUPAC name | 4-[(3,4-dichlorophenyl)methyl]piperidine;hydrochloride |
| InChIKey | QMXPLRLXVBJVNB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1CC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)