CAS 1864072-56-9 is the registry number for [1-(3,4-dichlorophenyl)cyclopentyl]methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[1-(3,4-dichlorophenyl)cyclopentyl]methanamine;hydrochloride (CAS 1864072-56-9) is a chemical compound with the molecular formula C12H16Cl3N and a molecular weight of 280.6 g/mol. IUPAC name: [1-(3,4-dichlorophenyl)cyclopentyl]methanamine;hydrochloride. InChIKey: SZPHBUILFYPRNC-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl3N |
|---|---|
| Molecular weight | 280.6 g/mol |
| IUPAC name | [1-(3,4-dichlorophenyl)cyclopentyl]methanamine;hydrochloride |
| InChIKey | SZPHBUILFYPRNC-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CN)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)