CAS 2060008-02-6 is the registry number for 2-((3,4-Dichlorophenyl)methyl)-2-methylpyrrolidine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(3,4-dichlorophenyl)methyl]-2-methylpyrrolidine;hydrochloride (CAS 2060008-02-6) is a chemical compound with the molecular formula C12H16Cl3N and a molecular weight of 280.6 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)methyl]-2-methylpyrrolidine;hydrochloride. InChIKey: NFXFXPWKVOUXJI-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl3N |
|---|---|
| Molecular weight | 280.6 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenyl)methyl]-2-methylpyrrolidine;hydrochloride |
| InChIKey | NFXFXPWKVOUXJI-UHFFFAOYSA-N |
| SMILES | CC1(CCCN1)CC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)