CAS 1820684-39-6 is the registry number for 1-Benzyl-3,3-bis(chloromethyl)azetidine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-benzyl-3,3-bis(chloromethyl)azetidine;hydrochloride (CAS 1820684-39-6) is a chemical compound with the molecular formula C12H16Cl3N and a molecular weight of 280.6 g/mol. IUPAC name: 1-benzyl-3,3-bis(chloromethyl)azetidine;hydrochloride. InChIKey: WFMBIYVXKYXRHZ-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl3N |
|---|---|
| Molecular weight | 280.6 g/mol |
| IUPAC name | 1-benzyl-3,3-bis(chloromethyl)azetidine;hydrochloride |
| InChIKey | WFMBIYVXKYXRHZ-UHFFFAOYSA-N |
| SMILES | C1C(CN1CC2=CC=CC=C2)(CCl)CCl.Cl |
Computed by PubChem (NCBI)