Products 1171332-00-5
CAS 1171332-00-5 appears in our catalog under these names: (3-(Aminomethyl)phenyl)(piperidin-1-yl)methanone hydrochloride, 98%, (3-(Piperidine-1-carbonyl)phenyl)methanamine hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 100mg, 1g.
[3-(aminomethyl)phenyl]-piperidin-1-ylmethanone;hydrochloride (CAS 1171332-00-5) is a chemical compound with the molecular formula C13H19ClN2O and a molecular weight of 254.75 g/mol. IUPAC name: [3-(aminomethyl)phenyl]-piperidin-1-ylmethanone;hydrochloride. InChIKey: JUKMYFGNCICHLC-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O |
|---|---|
| Molecular weight | 254.75 g/mol |
| IUPAC name | [3-(aminomethyl)phenyl]-piperidin-1-ylmethanone;hydrochloride |
| InChIKey | JUKMYFGNCICHLC-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)