CAS 1171410-42-6 is the registry number for 4,5,7-Trimethyl-6-phenyl-2,6-dihydro-1H-pyrrolo[3,4-d]pyridazin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5,7-trimethyl-6-phenyl-2H-pyrrolo[3,4-d]pyridazin-1-one (CAS 1171410-42-6) is a chemical compound with the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. IUPAC name: 4,5,7-trimethyl-6-phenyl-2H-pyrrolo[3,4-d]pyridazin-1-one. InChIKey: CKCDLVYDSKMVAG-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 4,5,7-trimethyl-6-phenyl-2H-pyrrolo[3,4-d]pyridazin-1-one |
| InChIKey | CKCDLVYDSKMVAG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NNC(=O)C2=C(N1C3=CC=CC=C3)C)C |
Computed by PubChem (NCBI)