Products 1642799-70-9
CAS 1642799-70-9 is the registry number for 3,3-Dimethyl-6-(2-methylpyrimidin-5-yl)indolin-2-one, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 5g.
3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1H-indol-2-one (CAS 1642799-70-9) is a chemical compound with the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. IUPAC name: 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1H-indol-2-one. InChIKey: KXXGECIQRKBEOA-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1H-indol-2-one |
| InChIKey | KXXGECIQRKBEOA-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=N1)C2=CC3=C(C=C2)C(C(=O)N3)(C)C |
Computed by PubChem (NCBI)