CAS 1213781-59-9 appears in our catalog under these names: N-Acetyl Varenicline, 1-(6,7,9,10-Tetrahydro-6,10-methano-8H-pyrazino(2,3-h)(3)benzazepin-8-yl)ethanone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
1-(5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl)ethanone (CAS 1213781-59-9) is a chemical compound with the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. IUPAC name: 1-(5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl)ethanone. InChIKey: YMNGQMBVFORKEO-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 1-(5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl)ethanone |
| InChIKey | YMNGQMBVFORKEO-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2CC(C1)C3=CC4=NC=CN=C4C=C23 |
Computed by PubChem (NCBI)