CAS 303995-06-4 is the registry number for (2E,4E)-2-Cyano-n-[(1e)-(dimethylamino)methylidene]-5-phenylpenta-2,4-dienamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2E,4E)-2-cyano-N-(dimethylaminomethylidene)-5-phenylpenta-2,4-dienamide (CAS 303995-06-4) is a chemical compound with the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. IUPAC name: (2E,4E)-2-cyano-N-(dimethylaminomethylidene)-5-phenylpenta-2,4-dienamide. InChIKey: UHZGGYCWUXPRDY-NOKFKHBCSA-N.
| Molecular formula | C15H15N3O |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | (2E,4E)-2-cyano-N-(dimethylaminomethylidene)-5-phenylpenta-2,4-dienamide |
| InChIKey | UHZGGYCWUXPRDY-NOKFKHBCSA-N |
| SMILES | CN(C)C=NC(=O)/C(=C/C=C/C1=CC=CC=C1)/C#N |
Computed by PubChem (NCBI)