Products 1171514-17-2
CAS 1171514-17-2 is the registry number for 2-(Cyclobutylcarbonyl)-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-(cyclobutanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (CAS 1171514-17-2) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: 2-(cyclobutanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid. InChIKey: PPNLVWGPZJLEAK-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | 2-(cyclobutanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| InChIKey | PPNLVWGPZJLEAK-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(=O)N2CCC3=C(C2)C4=C(N3)C=CC(=C4)C(=O)O |
Computed by PubChem (NCBI)