Products 722547-49-1
CAS 722547-49-1 is the registry number for Cefaclor Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-2-phenylacetate (CAS 722547-49-1) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-2-phenylacetate. InChIKey: GGOZBGIBZUPYGF-GJZGRUSLSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-2-phenylacetate |
| InChIKey | GGOZBGIBZUPYGF-GJZGRUSLSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1)NC(=O)[C@H](C2=CC=CC=C2)N |
Computed by PubChem (NCBI)