CAS 2088957-22-4 is the registry number for (3R,4S,5S)-3-Amino-5-(10H-phenoxazin-10-yl)tetrahydro-2H-pyran-4-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S,5S)-3-amino-5-phenoxazin-10-yloxan-4-ol (CAS 2088957-22-4) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: (3R,4S,5S)-3-amino-5-phenoxazin-10-yloxan-4-ol. InChIKey: XBAMOKTZAXSFKS-WHCBVINPSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | (3R,4S,5S)-3-amino-5-phenoxazin-10-yloxan-4-ol |
| InChIKey | XBAMOKTZAXSFKS-WHCBVINPSA-N |
| SMILES | C1[C@H]([C@@H]([C@H](CO1)N2C3=CC=CC=C3OC4=CC=CC=C42)O)N |
Computed by PubChem (NCBI)