CAS 66242-64-6 is the registry number for 4,5-Dihydroxy-1,3-dimethyl-4,5-diphenylimidazolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4,5-dihydroxy-1,3-dimethyl-4,5-diphenylimidazolidin-2-one (CAS 66242-64-6) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: 4,5-dihydroxy-1,3-dimethyl-4,5-diphenylimidazolidin-2-one. InChIKey: NXQPKFDLVDLKBZ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | 4,5-dihydroxy-1,3-dimethyl-4,5-diphenylimidazolidin-2-one |
| InChIKey | NXQPKFDLVDLKBZ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(C1(C2=CC=CC=C2)O)(C3=CC=CC=C3)O)C |
Computed by PubChem (NCBI)