CAS 1171916-82-7 is the registry number for 5-Bromo-1,1-difluoro-2,3-dihydro-1H-indene, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
6-bromo-3,3-difluoro-1,2-dihydroindene (CAS 1171916-82-7) is a chemical compound with the molecular formula C9H7BrF2 and a molecular weight of 233.05 g/mol. IUPAC name: 6-bromo-3,3-difluoro-1,2-dihydroindene. InChIKey: WXLDNJUQEYUTPC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2 |
|---|---|
| Molecular weight | 233.05 g/mol |
| IUPAC name | 6-bromo-3,3-difluoro-1,2-dihydroindene |
| InChIKey | WXLDNJUQEYUTPC-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C1C=C(C=C2)Br)(F)F |
Computed by PubChem (NCBI)