CAS 842140-35-6 is the registry number for 2-Bromo-3-(3,5-difluorophenyl)-1-propene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-bromoprop-2-enyl)-3,5-difluorobenzene (CAS 842140-35-6) is a chemical compound with the molecular formula C9H7BrF2 and a molecular weight of 233.05 g/mol. IUPAC name: 1-(2-bromoprop-2-enyl)-3,5-difluorobenzene. InChIKey: QVQUVTNCAAMBTB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2 |
|---|---|
| Molecular weight | 233.05 g/mol |
| IUPAC name | 1-(2-bromoprop-2-enyl)-3,5-difluorobenzene |
| InChIKey | QVQUVTNCAAMBTB-UHFFFAOYSA-N |
| SMILES | C=C(CC1=CC(=CC(=C1)F)F)Br |
Computed by PubChem (NCBI)