CAS 159276-58-1 is the registry number for Posaconazole Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromoprop-1-en-2-yl)-2,4-difluorobenzene (CAS 159276-58-1) is a chemical compound with the molecular formula C9H7BrF2 and a molecular weight of 233.05 g/mol. IUPAC name: 1-(3-bromoprop-1-en-2-yl)-2,4-difluorobenzene. InChIKey: VEHMGPJUOWKYRJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2 |
|---|---|
| Molecular weight | 233.05 g/mol |
| IUPAC name | 1-(3-bromoprop-1-en-2-yl)-2,4-difluorobenzene |
| InChIKey | VEHMGPJUOWKYRJ-UHFFFAOYSA-N |
| SMILES | C=C(CBr)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)