CAS 210113-74-9 is the registry number for 1-[(1E)-3-Bromo-1-propen-1-yl]-3,5-difluoro-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[(E)-3-bromoprop-1-enyl]-3,5-difluorobenzene (CAS 210113-74-9) is a chemical compound with the molecular formula C9H7BrF2 and a molecular weight of 233.05 g/mol. IUPAC name: 1-[(E)-3-bromoprop-1-enyl]-3,5-difluorobenzene. InChIKey: XWMNXLOOECHHDM-OWOJBTEDSA-N.
| Molecular formula | C9H7BrF2 |
|---|---|
| Molecular weight | 233.05 g/mol |
| IUPAC name | 1-[(E)-3-bromoprop-1-enyl]-3,5-difluorobenzene |
| InChIKey | XWMNXLOOECHHDM-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C=C1F)F)/C=C/CBr |
Computed by PubChem (NCBI)