CAS 1171924-23-4 is the registry number for 3-Benzylidene-5-(3,4-dimethoxyphenyl)-2,3-dihydrofuran, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(3E)-3-benzylidene-5-(3,4-dimethoxyphenyl)furan (CAS 1171924-23-4) is a chemical compound with the molecular formula C19H18O3 and a molecular weight of 294.3 g/mol. IUPAC name: (3E)-3-benzylidene-5-(3,4-dimethoxyphenyl)furan. InChIKey: AHQUFXOUKKABGF-XNTDXEJSSA-N.
| Molecular formula | C19H18O3 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | (3E)-3-benzylidene-5-(3,4-dimethoxyphenyl)furan |
| InChIKey | AHQUFXOUKKABGF-XNTDXEJSSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C/C(=C\C3=CC=CC=C3)/CO2)OC |
Computed by PubChem (NCBI)