Products 152041-27-5
CAS 152041-27-5 appears in our catalog under these names: Dehydroacerogenin C, Dehydroacerogenin C. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(10Z)-4-hydroxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),10,15,18-heptaen-12-one (CAS 152041-27-5) is a chemical compound with the molecular formula C19H18O3 and a molecular weight of 294.3 g/mol. IUPAC name: (10Z)-4-hydroxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),10,15,18-heptaen-12-one. InChIKey: XYHMPDDSCDAZOB-RQOWECAXSA-N.
| Molecular formula | C19H18O3 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | (10Z)-4-hydroxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),10,15,18-heptaen-12-one |
| InChIKey | XYHMPDDSCDAZOB-RQOWECAXSA-N |
| SMILES | C/1CC2=CC(=C(C=C2)O)OC3=CC=C(CCC(=O)/C=C1)C=C3 |
Computed by PubChem (NCBI)
Synonyms:
Dehydroacerogenin C