Products 255836-90-9

CAS 255836-90-9 is the registry number for α-(4-Carboxyphenyl)-β-tetralone ethyl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Ethyl 4-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)benzoate (CAS 255836-90-9) is a chemical compound with the molecular formula C19H18O3 and a molecular weight of 294.3 g/mol. IUPAC name: ethyl 4-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)benzoate. InChIKey: COESFCDZCRFHJI-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18O3
Molecular weight294.3 g/mol
IUPAC nameethyl 4-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)benzoate
InChIKeyCOESFCDZCRFHJI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)C2C(=O)CCC3=CC=CC=C23

Computed by PubChem (NCBI)