CAS 20958-15-0 appears in our catalog under these names: Isotanshinone IIA, Isotanshinone IIA, 98.0%. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 10mg, 5mg, 50mg, 1 mg, 5 mg.
4,4,8-trimethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione (CAS 20958-15-0) is a chemical compound with the molecular formula C19H18O3 and a molecular weight of 294.3 g/mol. IUPAC name: 4,4,8-trimethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione. InChIKey: QHGPIJMPUOVBOL-UHFFFAOYSA-N.
| Molecular formula | C19H18O3 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 4,4,8-trimethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione |
| InChIKey | QHGPIJMPUOVBOL-UHFFFAOYSA-N |
| SMILES | CC1=COC2=C1C(=O)C3=C(C2=O)C4=C(C=C3)C(CCC4)(C)C |
Computed by PubChem (NCBI)