Products 1171924-35-8

CAS 1171924-35-8 is the registry number for 2-Hydroxy-6-((phenylthio)methyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

2-hydroxy-6-(phenylsulfanylmethyl)benzoic acid (CAS 1171924-35-8) is a chemical compound with the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. IUPAC name: 2-hydroxy-6-(phenylsulfanylmethyl)benzoic acid. InChIKey: YLAXWQBBDJBRJK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O3S
Molecular weight260.31 g/mol
IUPAC name2-hydroxy-6-(phenylsulfanylmethyl)benzoic acid
InChIKeyYLAXWQBBDJBRJK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)SCC2=C(C(=CC=C2)O)C(=O)O

Computed by PubChem (NCBI)