CAS 171503-27-8 appears in our catalog under these names: 2-[(4-Methylphenyl)sulfonyl]benzaldehyde, 95%, 2-Tosylbenzaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-(4-methylphenyl)sulfonylbenzaldehyde (CAS 171503-27-8) is a chemical compound with the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonylbenzaldehyde. InChIKey: ORSXVDXFBGUMIE-UHFFFAOYSA-N.
| Molecular formula | C14H12O3S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonylbenzaldehyde |
| InChIKey | ORSXVDXFBGUMIE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)