Products 21120-66-1

CAS 21120-66-1 is the registry number for 4-(4-Methylsulfanyl-phenoxy)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(4-methylsulfanylphenoxy)benzoic acid (CAS 21120-66-1) is a chemical compound with the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. IUPAC name: 4-(4-methylsulfanylphenoxy)benzoic acid. InChIKey: FSCFSOJHTJBESJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O3S
Molecular weight260.31 g/mol
IUPAC name4-(4-methylsulfanylphenoxy)benzoic acid
InChIKeyFSCFSOJHTJBESJ-UHFFFAOYSA-N
SMILESCSC1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)