CAS 640769-68-2 is the registry number for 4'-(Methylsulfonyl)-(1,1'-biphenyl)-4-carbaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-(4-methylsulfonylphenyl)benzaldehyde (CAS 640769-68-2) is a chemical compound with the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. IUPAC name: 4-(4-methylsulfonylphenyl)benzaldehyde. InChIKey: PPABKICZMQVESD-UHFFFAOYSA-N.
| Molecular formula | C14H12O3S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 4-(4-methylsulfonylphenyl)benzaldehyde |
| InChIKey | PPABKICZMQVESD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)