Products 117197-81-6

CAS 117197-81-6 is the registry number for 1-(2-(2-Hydroxyethoxy)ethyl) Hexanedioic Acid Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

6-[2-(2-hydroxyethoxy)ethoxy]-6-oxohexanoic acid (CAS 117197-81-6) is a chemical compound with the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. IUPAC name: 6-[2-(2-hydroxyethoxy)ethoxy]-6-oxohexanoic acid. InChIKey: BATDEVCTYREDAX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O6
Molecular weight234.25 g/mol
IUPAC name6-[2-(2-hydroxyethoxy)ethoxy]-6-oxohexanoic acid
InChIKeyBATDEVCTYREDAX-UHFFFAOYSA-N
SMILESC(CCC(=O)OCCOCCO)CC(=O)O

Computed by PubChem (NCBI)