CAS 2456391-60-7 appears in our catalog under these names: 2-(2-(2-(tert-Butoxy)-2-oxoethoxy)ethoxy)acetic acid 95%, 2-(2-(2-(tert-Butoxy)-2-oxoethoxy)ethoxy)acetic acid, 95%, 95%, 2-(2-(2-(tert-Butoxy)-2-oxoethoxy)ethoxy)acetic acid, 2-(2-(2-(tert-Butoxy)-2-oxoethoxy)ethoxy)acetic acid, 98%. Offered by: Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 100 mg, 250 mg, 1 g.
2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethoxy]acetic acid (CAS 2456391-60-7) is a chemical compound with the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. IUPAC name: 2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethoxy]acetic acid. InChIKey: JEJKTBLNUPQRIQ-UHFFFAOYSA-N.
| Molecular formula | C10H18O6 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethoxy]acetic acid |
| InChIKey | JEJKTBLNUPQRIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCC(=O)O |
Computed by PubChem (NCBI)