CAS 62961-64-2 appears in our catalog under these names: D-(-)-Diisopropyl Tartrate, Diisopropyl D–(–)–Tartrate, (-)-Diisopropyl D-tartrate, 98% , Diisopropyl D-tartrate, Diisopropyl D-(-)-Tartrate, >98.0%(GC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 25g, 5g, 100g, 500g, 50g, 0,05kg, 0,025kg.
Dipropan-2-yl (2S,3S)-2,3-dihydroxybutanedioate (CAS 62961-64-2) is a chemical compound with the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. IUPAC name: dipropan-2-yl (2S,3S)-2,3-dihydroxybutanedioate. InChIKey: XEBCWEDRGPSHQH-YUMQZZPRSA-N.
| Molecular formula | C10H18O6 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | dipropan-2-yl (2S,3S)-2,3-dihydroxybutanedioate |
| InChIKey | XEBCWEDRGPSHQH-YUMQZZPRSA-N |
| SMILES | CC(C)OC(=O)[C@H]([C@@H](C(=O)OC(C)C)O)O |
Computed by PubChem (NCBI)