CAS 200396-09-4 is the registry number for 1-Methyl-2-propenylbeta-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
(2R,3R,4S,5S,6R)-2-but-3-en-2-yloxy-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 200396-09-4) is a chemical compound with the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. IUPAC name: (2R,3R,4S,5S,6R)-2-but-3-en-2-yloxy-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: XGTASPLAYLTKAF-MZLYOKELSA-N.
| Molecular formula | C10H18O6 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | (2R,3R,4S,5S,6R)-2-but-3-en-2-yloxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | XGTASPLAYLTKAF-MZLYOKELSA-N |
| SMILES | CC(C=C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)