Products 1172028-71-5
CAS 1172028-71-5 appears in our catalog under these names: 4-[(Cyclopropylamino)methyl]benzamide hydrochloride, 95%, 4-((Cyclopropylamino)methyl)benzamide hydrochloride, 95%, 4-((Cyclopropylamino)methyl)benzamide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-[(cyclopropylamino)methyl]benzamide;hydrochloride (CAS 1172028-71-5) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: 4-[(cyclopropylamino)methyl]benzamide;hydrochloride. InChIKey: VSUFQFVTNUUXCW-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 4-[(cyclopropylamino)methyl]benzamide;hydrochloride |
| InChIKey | VSUFQFVTNUUXCW-UHFFFAOYSA-N |
| SMILES | C1CC1NCC2=CC=C(C=C2)C(=O)N.Cl |
Computed by PubChem (NCBI)