CAS 1172560-74-5 is the registry number for 1-(3,4-Dichlorophenyl)-5-methyl-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3,4-dichlorophenyl)-5-methylpyrazol-3-amine (CAS 1172560-74-5) is a chemical compound with the molecular formula C10H9Cl2N3 and a molecular weight of 242.10 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-5-methylpyrazol-3-amine. InChIKey: USSHBVIHSHGDMT-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-5-methylpyrazol-3-amine |
| InChIKey | USSHBVIHSHGDMT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC(=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)