CAS 1173019-42-5 appears in our catalog under these names: Carprofen–d3, Carprofen-d3, rac Carprofen-d3, >95% (HPLC), CARPROFEN-D3 VETRANAL., D3-Carprofen, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: GLPBio, Hubei YoungXin, TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5 mg.
2-(6-chloro-9H-carbazol-2-yl)-3,3,3-trideuteriopropanoic acid (CAS 1173019-42-5) is a chemical compound with the molecular formula C15H12ClNO2 and a molecular weight of 276.73 g/mol. IUPAC name: 2-(6-chloro-9H-carbazol-2-yl)-3,3,3-trideuteriopropanoic acid. InChIKey: PUXBGTOOZJQSKH-FIBGUPNXSA-N.
| Molecular formula | C15H12ClNO2 |
|---|---|
| Molecular weight | 276.73 g/mol |
| IUPAC name | 2-(6-chloro-9H-carbazol-2-yl)-3,3,3-trideuteriopropanoic acid |
| InChIKey | PUXBGTOOZJQSKH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)