CAS 2012598-34-2 is the registry number for Carprofen-13C,d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-(6-chloro-9H-carbazol-2-yl)-3,3,3-trideuterio(313C)propanoic acid (CAS 2012598-34-2) is a chemical compound with the molecular formula C15H12ClNO2 and a molecular weight of 277.72 g/mol. IUPAC name: 2-(6-chloro-9H-carbazol-2-yl)-3,3,3-trideuterio(313C)propanoic acid. InChIKey: PUXBGTOOZJQSKH-KQORAOOSSA-N.
| Molecular formula | C15H12ClNO2 |
|---|---|
| Molecular weight | 277.72 g/mol |
| IUPAC name | 2-(6-chloro-9H-carbazol-2-yl)-3,3,3-trideuterio(313C)propanoic acid |
| InChIKey | PUXBGTOOZJQSKH-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])C(C1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)