Products 1173019-51-6
CAS 1173019-51-6 appears in our catalog under these names: Diethylamine-d11, 99 atom % D, min 98% Chemical Purity, Diethylamine-d11. Offered by: CDN, Biosynth. Available pack sizes: 0,25g, 0,1g, 50mg, 100mg.
N,1,1,2,2,2-hexadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine (CAS 1173019-51-6) is a chemical compound with the molecular formula C4H11N and a molecular weight of 84.20 g/mol. IUPAC name: N,1,1,2,2,2-hexadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine. InChIKey: HPNMFZURTQLUMO-REUZILGJSA-N.
| Molecular formula | C4H11N |
|---|---|
| Molecular weight | 84.20 g/mol |
| IUPAC name | N,1,1,2,2,2-hexadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine |
| InChIKey | HPNMFZURTQLUMO-REUZILGJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)