Products 60455-40-5
CAS 60455-40-5 is the registry number for Diethyl-1,1,1',1'-d4-amine, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
1,1-dideuterio-N-(1,1-dideuterioethyl)ethanamine (CAS 60455-40-5) is a chemical compound with the molecular formula C4H11N and a molecular weight of 77.16 g/mol. IUPAC name: 1,1-dideuterio-N-(1,1-dideuterioethyl)ethanamine. InChIKey: HPNMFZURTQLUMO-KHORGVISSA-N.
| Molecular formula | C4H11N |
|---|---|
| Molecular weight | 77.16 g/mol |
| IUPAC name | 1,1-dideuterio-N-(1,1-dideuterioethyl)ethanamine |
| InChIKey | HPNMFZURTQLUMO-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C)NC([2H])([2H])C |
Computed by PubChem (NCBI)