Products 51045-01-3

CAS 51045-01-3 is the registry number for Diethyl-2,2,2,2',2',2'-d6-amine, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

2,2,2-trideuterio-N-(2,2,2-trideuterioethyl)ethanamine (CAS 51045-01-3) is a chemical compound with the molecular formula C4H11N and a molecular weight of 79.17 g/mol. IUPAC name: 2,2,2-trideuterio-N-(2,2,2-trideuterioethyl)ethanamine. InChIKey: HPNMFZURTQLUMO-WFGJKAKNSA-N.

Identity
Molecular formulaC4H11N
Molecular weight79.17 g/mol
IUPAC name2,2,2-trideuterio-N-(2,2,2-trideuterioethyl)ethanamine
InChIKeyHPNMFZURTQLUMO-WFGJKAKNSA-N
SMILES[2H]C([2H])([2H])CNCC([2H])([2H])[2H]

Computed by PubChem (NCBI)