Products 120092-66-2
CAS 120092-66-2 appears in our catalog under these names: Diethyl-d10-amine, Diethyl-d10-amine, 99 atom % D, min 98% Chemical Purity, DIETHYL-D10-AMINE, 98 ATOM % D. Offered by: TRC, CDN, Biosynth, Sigma-Aldrich. Available pack sizes: 25mg, 500mg, 1g, 0,5g.
1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine (CAS 120092-66-2) is a chemical compound with the molecular formula C4H11N and a molecular weight of 83.20 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine. InChIKey: HPNMFZURTQLUMO-MWUKXHIBSA-N.
| Molecular formula | C4H11N |
|---|---|
| Molecular weight | 83.20 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine |
| InChIKey | HPNMFZURTQLUMO-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)